CymitQuimica logo

CAS 100319-40-2

:

1-ETHYL-4-(2-METHYLPROPYL)BENZENE

Description:
1-Ethyl-4-(2-methylpropyl)benzene, also known by its CAS number 100319-40-2, is an organic compound characterized by a benzene ring substituted with an ethyl group and a 2-methylpropyl group. This compound belongs to the class of alkyl-substituted benzenes, which are known for their hydrophobic properties and potential applications in organic synthesis and as solvents. The presence of the ethyl and 2-methylpropyl groups contributes to its branched structure, influencing its physical properties such as boiling point, melting point, and solubility. Typically, such compounds exhibit moderate volatility and are less soluble in water due to their nonpolar characteristics. Additionally, they may participate in various chemical reactions, including electrophilic aromatic substitution, making them valuable intermediates in the synthesis of more complex organic molecules. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.
Formula:C12H18
InChI:InChI=1S/C12H18/c1-4-11-5-7-12(8-6-11)9-10(2)3/h5-8,10H,4,9H2,1-3H3
InChI key:FMHWAAZOTFVMKR-UHFFFAOYSA-N
SMILES:CCC1=CC=C(C=C1)CC(C)C
Synonyms:
  • Ibuprofen Imp B2
  • 1-Ethyl-4-Isobutylbenzene
Found 8 products.