CymitQuimica logo

CAS 1003298-85-8

:

B-[3,5-Dichloro-4-(phenylmethoxy)phenyl]boronic acid

Description:
B-[3,5-Dichloro-4-(phenylmethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenylmethoxy group and dichlorinated phenyl moiety, contributing to its unique reactivity and potential biological activity. Typically, boronic acids exhibit moderate solubility in polar solvents and can participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is valuable in the formation of carbon-carbon bonds. The presence of chlorine substituents can influence the electronic properties and reactivity of the compound, potentially enhancing its interactions in biological systems. Additionally, boronic acids are often studied for their role in drug development, particularly in targeting specific biomolecules. Overall, B-[3,5-Dichloro-4-(phenylmethoxy)phenyl]boronic acid represents a versatile structure with significant implications in both synthetic and medicinal chemistry.
Formula:C13H11BCl2O3
InChI:InChI=1S/C13H11BCl2O3/c15-11-6-10(14(17)18)7-12(16)13(11)19-8-9-4-2-1-3-5-9/h1-7,17-18H,8H2
InChI key:InChIKey=BAXPPGSWZDNMOG-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(Cl)C=C(B(O)O)C=C2Cl
Synonyms:
  • Boronic acid, B-[3,5-dichloro-4-(phenylmethoxy)phenyl]-
  • (4-(Benzyloxy)-3,5-dichlorophenyl)boronicacid
  • [4-(Benzyloxy)-3,5-dichlorophenyl]boronic acid
  • (3,5-Dichloro-4-phenylmethoxyphenyl)boronic acid
  • B-[3,5-Dichloro-4-(phenylmethoxy)phenyl]boronic acid
Found 3 products.