CymitQuimica logo

CAS 1003561-96-3

:

Pyrrolidine, 3-[(4-methylphenyl)methyl]-, hydrochloride (1:1)

Description:
Pyrrolidine, 3-[(4-methylphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a 4-methylphenylmethyl group at the 3-position of the pyrrolidine ring contributes to its unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit psychoactive properties and has been studied for its potential effects on the central nervous system. Its molecular structure suggests it could interact with neurotransmitter systems, although specific pharmacological effects would depend on further empirical studies. Safety and handling precautions are essential, as with many amines and their derivatives, due to potential toxicity and reactivity. Overall, this compound represents a class of substances that may have significant implications in medicinal chemistry and drug development.
Formula:C12H17N·ClH
InChI:InChI=1S/C12H17N.ClH/c1-10-2-4-11(5-3-10)8-12-6-7-13-9-12;/h2-5,12-13H,6-9H2,1H3;1H
InChI key:InChIKey=HNJRIYXWXCEXQZ-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C)C=C1)C2CCNC2.Cl
Synonyms:
  • Pyrrolidine, 3-[(4-methylphenyl)methyl]-, hydrochloride (1:1)
Found 2 products.