CymitQuimica logo

CAS 10036-43-8

:

3-Fluorobenzyl cyanide

Description:
3-Fluorobenzyl cyanide, with the CAS number 10036-43-8, is an organic compound characterized by the presence of both a fluorobenzyl group and a cyanide functional group. It features a benzene ring substituted with a fluorine atom at the meta position and a cyanide group (-C≡N) attached to a benzyl carbon. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the fluorine atom can influence the compound's reactivity and polarity, making it useful in various chemical reactions. Additionally, like many cyanides, it poses significant health risks, including toxicity, and requires careful handling and storage. Its physical and chemical properties, such as boiling point, melting point, and solubility, are influenced by the functional groups present, which can affect its behavior in different chemical environments.
Formula:C8H6FN
InChI:InChI=1/C8H6FN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2
SMILES:c1cc(CC#N)cc(c1)F
Synonyms:
  • 3-Fluorophenylacetonitrile
  • M-Fluorobenzyl cyanide
Sort by

Found 1 products.