CAS 100367-78-0
:Hydrazine, (2-bromo-5-nitrophenyl)-
Description:
Hydrazine, (2-bromo-5-nitrophenyl)-, with the CAS number 100367-78-0, is an organic compound characterized by the presence of both bromine and nitro functional groups attached to a phenyl ring. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. The presence of the nitro group contributes to its potential as an electron-withdrawing group, which can influence its reactivity and stability. Hydrazine derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The bromine substituent can enhance the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, compounds containing hydrazine moieties are known for their potential as reducing agents. However, due to the presence of both bromine and nitro groups, this specific hydrazine derivative may exhibit unique properties and reactivity patterns that warrant careful handling and consideration in laboratory settings. Safety precautions are essential, as hydrazine compounds can be toxic and potentially hazardous.
Formula:C6H6BrN3O2
InChI:InChI=1S/C6H6BrN3O2/c7-5-2-1-4(10(11)12)3-6(5)9-8/h1-3,9H,8H2
InChI key:YGKPMXOMDNPDHO-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1[N+](=O)[O-])NN)Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
