CymitQuimica logo

CAS 100368-29-4

:

3-Oxa-9-azabicyclo[3.3.1]nonane, hydrochloride

Description:
3-Oxa-9-azabicyclo[3.3.1]nonane, hydrochloride, is a bicyclic compound characterized by its unique structural framework, which includes both nitrogen and oxygen atoms within its rings. This compound features a bicyclic system that consists of a nine-membered ring structure, where the presence of the nitrogen atom contributes to its basicity and potential for forming salts, such as the hydrochloride form. The hydrochloride salt enhances its solubility in water, making it more accessible for various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity, potentially acting as a ligand or influencing neurotransmitter systems due to its structural similarities to other biologically active molecules. Its synthesis typically involves multi-step organic reactions, and it may be utilized in research related to medicinal chemistry or neuropharmacology. As with many nitrogen-containing heterocycles, it may also display interesting properties such as chirality, which can influence its interaction with biological targets. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C7H13NO・ClH
InChI:InChI=1S/C7H13NO.ClH/c1-2-6-4-9-5-7(3-1)8-6;/h6-8H,1-5H2;1H
InChI key:CNFLTPZHQBRTRQ-UHFFFAOYSA-N
SMILES:C1CC2COCC(C1)N2.Cl
Found 3 products.