CymitQuimica logo

CAS 1003708-24-4

:

1-Bromo-2,3-difluoro-4-nitrobenzene

Description:
1-Bromo-2,3-difluoro-4-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, two fluorine atoms, and a nitro group attached to a benzene ring. This compound features a bromine substituent at the first position, two fluorine substituents at the second and third positions, and a nitro group at the fourth position of the benzene ring, which contributes to its reactivity and polarity. The presence of electronegative halogens (bromine and fluorine) and the nitro group significantly influences its chemical properties, including its potential as an electrophile in various reactions. The compound is likely to exhibit moderate solubility in organic solvents and may be less soluble in water due to its hydrophobic aromatic structure. Additionally, the nitro group can enhance the compound's reactivity in nucleophilic substitution reactions. Safety precautions should be taken when handling this substance, as it may pose health risks due to its halogenated and nitro functionalities.
Formula:C6H2BrF2NO2
InChI:InChI=1S/C6H2BrF2NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H
InChI key:GXNBBNIEEJTQST-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1Br)F)F)N(=O)=O
Synonyms:
  • Benzene, 1-bromo-2,3-difluoro-4-nitro-
  • 2,3-Difluoro-4-bromonitrobenzene
Found 4 products.