CymitQuimica logo

CAS 1003708-27-7

:

4-Amino-2,6-diethylbenzonitrile

Description:
4-Amino-2,6-diethylbenzonitrile is an organic compound characterized by the presence of an amino group and a nitrile functional group attached to a benzene ring that is further substituted with two ethyl groups. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the ethyl substituents. The amino group contributes to its potential as a nucleophile in various chemical reactions, while the nitrile group can participate in reactions such as hydrolysis or reduction. The presence of multiple substituents on the benzene ring can influence its reactivity and physical properties, such as melting and boiling points. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C11H14N2
InChI:InChI=1S/C11H14N2/c1-3-8-5-10(13)6-9(4-2)11(8)7-12/h5-6H,3-4,13H2,1-2H3
InChI key:MEBZCJQSHLJQPC-UHFFFAOYSA-N
SMILES:CCC1=CC(=CC(=C1C#N)CC)N
Found 2 products.