CAS 1003708-31-3

2-Bromo-1-nitro-4-(trifluoromethoxy)benzene

Description:

2-Bromo-1-nitro-4-(trifluoromethoxy)benzene is an organic compound characterized by the presence of a bromine atom, a nitro group, and a trifluoromethoxy group attached to a benzene ring. The bromine atom introduces a halogen functionality, which can enhance the compound's reactivity in nucleophilic substitution reactions. The nitro group is a strong electron-withdrawing group, which can influence the compound's electronic properties and reactivity, making it a potential candidate for various chemical transformations. The trifluoromethoxy group contributes to the compound's lipophilicity and can affect its solubility in organic solvents. This compound may exhibit interesting biological activities due to its unique structural features, making it of interest in medicinal chemistry and material science. Additionally, its molecular structure suggests potential applications in the synthesis of more complex molecules or as an intermediate in organic synthesis. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.

Formula: C₇H₃BrF₃NO₃

InChI: InChI=1S/C7H3BrF3NO3/c8-5-3-4(15-7(9,10)11)1-2-6(5)12(13)14/h1-3H

InChI key: InChIKey=KIGJNTZXRXZBQO-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(Br)C=C(OC(F)(F)F)C=C1

Synonyms:

• 2-Bromo-4-(trifluoromethoxy)nitrobenzene
• Benzene, 2-bromo-1-nitro-4-(trifluoromethoxy)-
• 2-Bromo-1-nitro-4-(trifluoromethoxy)benzene

2-Bromo-4-(trifluoromethoxy)nitrobenzene

CAS: 1003708-31-3

Formula: C₇H₃BrF₃NO₃

Color and Shape: Liquid

Molecular weight: 286.0028

Ref: IN-DA0001R4