CAS 1003708-31-3
:2-Bromo-1-nitro-4-(trifluoromethoxy)benzene
Description:
2-Bromo-1-nitro-4-(trifluoromethoxy)benzene is an organic compound characterized by the presence of a bromine atom, a nitro group, and a trifluoromethoxy group attached to a benzene ring. The bromine atom introduces a halogen functionality, which can enhance the compound's reactivity in nucleophilic substitution reactions. The nitro group is a strong electron-withdrawing group, which can influence the compound's electronic properties and reactivity, making it a potential candidate for various chemical transformations. The trifluoromethoxy group contributes to the compound's lipophilicity and can affect its solubility in organic solvents. This compound may exhibit interesting biological activities due to its unique structural features, making it of interest in medicinal chemistry and material science. Additionally, its molecular structure suggests potential applications in the synthesis of more complex molecules or as an intermediate in organic synthesis. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C7H3BrF3NO3
InChI:InChI=1S/C7H3BrF3NO3/c8-5-3-4(15-7(9,10)11)1-2-6(5)12(13)14/h1-3H
InChI key:InChIKey=KIGJNTZXRXZBQO-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(Br)C=C(OC(F)(F)F)C=C1
Synonyms:- 2-Bromo-4-(trifluoromethoxy)nitrobenzene
- Benzene, 2-bromo-1-nitro-4-(trifluoromethoxy)-
- 2-Bromo-1-nitro-4-(trifluoromethoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Bromo-4-(Trifluoromethoxy)Nitrobenzene
CAS:Formula:C7H3BrF3NO3Color and Shape:LiquidMolecular weight:286.0028
