CymitQuimica logo

CAS 1003708-82-4

:

4,5-Difluoro-2-Methylbenzonitrile

Description:
4,5-Difluoro-2-methylbenzonitrile is an aromatic compound characterized by the presence of a benzene ring substituted with two fluorine atoms and a methyl group, along with a cyano group (–C≡N). The fluorine substituents are located at the 4 and 5 positions relative to the methyl group at the 2 position, which influences the compound's electronic properties and reactivity. This compound typically exhibits a high degree of lipophilicity due to the presence of the fluorine atoms, which can enhance its stability and alter its interaction with biological systems. The cyano group contributes to its polarity and can participate in various chemical reactions, making it a useful intermediate in organic synthesis. Additionally, 4,5-difluoro-2-methylbenzonitrile may exhibit interesting physical properties such as melting and boiling points that are influenced by its molecular structure and substituents. Its applications can range from pharmaceuticals to agrochemicals, depending on its reactivity and functional properties. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C8H5F2N
InChI:InChI=1S/C8H5F2N/c1-5-2-7(9)8(10)3-6(5)4-11/h2-3H,1H3
InChI key:NEUWJWYFYDQUMY-UHFFFAOYSA-N
SMILES:Cc1cc(c(cc1C#N)F)F
Found 4 products.