CymitQuimica logo

CAS 1003709-39-4

:

2-Bromo-4-fluoro-5-methylbenzoic acid

Description:
2-Bromo-4-fluoro-5-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a bromine atom at the second position, a fluorine atom at the fourth position, and a methyl group at the fifth position of the benzene ring. This compound typically exhibits properties associated with halogenated benzoic acids, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic structure. The presence of both bromine and fluorine introduces significant electronegativity, which can influence the compound's reactivity and potential applications in organic synthesis and medicinal chemistry. The carboxylic acid functional group contributes to its acidity, making it a weak acid. Additionally, the specific arrangement of substituents can affect its biological activity and interactions with other molecules. Overall, 2-Bromo-4-fluoro-5-methylbenzoic acid is of interest in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features.
Formula:C8H6BrFO2
InChI:InChI=1S/C8H6BrFO2/c1-4-2-5(8(11)12)6(9)3-7(4)10/h2-3H,1H3,(H,11,12)
InChI key:UVSGTNJGIMPLAM-UHFFFAOYSA-N
SMILES:Cc1cc(c(cc1F)Br)C(=O)O
Synonyms:
  • Benzoic acid, 2-bromo-4-fluoro-5-methyl-
Found 5 products.