CymitQuimica logo

CAS 1003709-54-3

:

2-Bromo-5-fluoro-4-methylbenzoic acid

Description:
2-Bromo-5-fluoro-4-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom, a fluorine atom, and a methyl group on a benzoic acid framework. The molecular structure features a benzene ring substituted at the 2, 4, and 5 positions, which influences its chemical reactivity and physical properties. This compound typically exhibits moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the aromatic ring. The presence of halogen substituents (bromine and fluorine) can enhance its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can affect its interactions in biological systems. Overall, 2-Bromo-5-fluoro-4-methylbenzoic acid is a valuable compound in organic chemistry with applications in research and industry.
Formula:C8H6BrFO2
InChI:InChI=1S/C8H6BrFO2/c1-4-2-6(9)5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12)
InChI key:WFPYJWBPQCXYCJ-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1F)C(=O)O)Br
Found 4 products.