CymitQuimica logo

CAS 1003709-80-5

:

2,4-Difluoro-3,5-dimethoxybenzoic acid

Description:
2,4-Difluoro-3,5-dimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and two methoxy groups on a benzene ring. The fluorine substituents are located at the 2 and 4 positions, while the methoxy groups are positioned at the 3 and 5 positions, contributing to the compound's unique electronic and steric properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents due to the presence of the polar carboxylic acid group and the non-polar methoxy groups. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of compounds with specific biological activities or as intermediates in synthetic pathways. The presence of fluorine can enhance lipophilicity and metabolic stability, making it a subject of interest in medicinal chemistry. As with many fluorinated compounds, it may exhibit unique reactivity and interaction profiles, which can be explored in various chemical contexts.
Formula:C9H8F2O4
InChI:InChI=1S/C9H8F2O4/c1-14-5-3-4(9(12)13)6(10)8(15-2)7(5)11/h3H,1-2H3,(H,12,13)
InChI key:LLRUPRYHYIFLJS-UHFFFAOYSA-N
SMILES:COc1cc(c(c(c1F)OC)F)C(=O)O
Synonyms:
  • 2,4-Difluoro-3,5-dimethoxybenzoato
Found 6 products.