CymitQuimica logo

CAS 1003709-96-3

:

2,3-Difluoro-5-methylbenzoic acid

Description:
2,3-Difluoro-5-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methyl group on a benzoic acid framework. The fluorine substituents are located at the 2 and 3 positions, while the methyl group is at the 5 position of the benzene ring. This compound exhibits typical properties of benzoic acids, including the ability to form hydrogen bonds due to its carboxylic acid functional group, which contributes to its solubility in polar solvents. The presence of fluorine atoms enhances the compound's acidity compared to non-fluorinated benzoic acids, as fluorine is highly electronegative and can stabilize the carboxylate ion formed upon deprotonation. Additionally, the fluorine substituents can influence the compound's reactivity and interaction with biological systems, making it of interest in medicinal chemistry and material science. Its unique structure may also impart specific physical properties, such as altered melting and boiling points compared to its non-fluorinated counterparts.
Formula:C8H6F2O2
InChI:InChI=1S/C8H6F2O2/c1-4-2-5(8(11)12)7(10)6(9)3-4/h2-3H,1H3,(H,11,12)
InChI key:PJDCKKOTZDVVOV-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C(=C1)F)F)C(=O)O
Found 4 products.