CAS 1003710-73-3

2-Amino-4-chloro-3-pyridinol

Description:

2-Amino-4-chloro-3-pyridinol is an organic compound characterized by its pyridine ring, which is substituted with an amino group and a chlorine atom. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The chlorine atom introduces a halogen functionality, influencing its reactivity and potential applications in various chemical reactions. 2-Amino-4-chloro-3-pyridinol is of interest in medicinal chemistry and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its structure suggests potential biological activity, making it a candidate for further research in drug development. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted to understand its handling and toxicity, as with any chemical substance. Overall, 2-Amino-4-chloro-3-pyridinol represents a versatile building block in organic synthesis.

Formula: C₅H₅ClN₂O

InChI: InChI=1S/C5H5ClN2O/c6-3-1-2-8-5(7)4(3)9/h1-2,9H,(H2,7,8)

SMILES: c1c[nH]c(=N)c(c1Cl)O

2-Amino-4-chloropyridin-3-ol

CAS: 1003710-73-3

Formula: C₅H₅ClN₂O

Purity: 95%+

Color and Shape: Solid

Molecular weight: 144.5590

Ref: IN-DA0001RP

2-Amino-4-chloropyridin-3-ol

CAS: 1003710-73-3

Versatile small molecule scaffold

Formula: C₅H₅ClN₂O

Purity: Min. 95%

Molecular weight: 144.56 g/mol

Ref: 3D-DQB71073