CymitQuimica logo

CAS 1003711-39-4

:

6-Bromo-2-methyl-3-pyridinecarbonitrile

Description:
6-Bromo-2-methyl-3-pyridinecarbonitrile is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 6-position and a methyl group at the 2-position contributes to its unique chemical properties. The cyano group (-C≡N) at the 3-position enhances its reactivity, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure allows for potential interactions in biological systems, which can be explored for pharmacological activities. Additionally, the presence of both halogen and cyano functionalities suggests that it may participate in nucleophilic substitution reactions and other transformations, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C7H5BrN2
InChI:InChI=1S/C7H5BrN2/c1-5-6(4-9)2-3-7(8)10-5/h2-3H,1H3
InChI key:InChIKey=VXLPCDPMLFDENY-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C)N=C(Br)C=C1
Synonyms:
  • 6-Bromo-2-methylnicotinonitrile
  • 6-Bromo-2-methyl-3-pyridinecarbonitrile
  • 3-Pyridinecarbonitrile, 6-bromo-2-methyl-
  • 2-Bromo-5-cyano-6-picoline
Found 4 products.