CymitQuimica logo

CAS 1003712-14-8

:

3'-Iodo-5'-bromoacetophenone

Description:
3'-Iodo-5'-bromoacetophenone is an organic compound characterized by the presence of both iodine and bromine substituents on the aromatic ring of acetophenone. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The iodine and bromine atoms introduce significant electrophilic characteristics, making the compound useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of these halogens can also influence the compound's physical properties, such as solubility and boiling point, as well as its reactivity in different environments. Additionally, 3'-Iodo-5'-bromoacetophenone may exhibit biological activity, which can be explored in medicinal chemistry. Its structural features allow for potential modifications, making it a valuable intermediate in the synthesis of more complex molecules. As with many halogenated compounds, safety precautions should be taken when handling this substance due to the potential hazards associated with halogenated organic compounds.
Formula:C8H6BrIO
InChI:InChI=1S/C8H6BrIO/c1-5(11)6-2-7(9)4-8(10)3-6/h2-4H,1H3
InChI key:ZTUMZGVEBVJSBY-UHFFFAOYSA-N
SMILES:CC(=O)C1=CC(=CC(=C1)I)Br
Synonyms:
  • Ethanone, 1-(3-bromo-5-iodophenyl)-
  • 3'-Iodo-5'-bromoacetophenone
Found 4 products.