CymitQuimica logo

CAS 100372-62-1

:

1H-Indole-3-propanoic acid, 5-methoxy-, methyl ester

Description:
1H-Indole-3-propanoic acid, 5-methoxy-, methyl ester, commonly referred to as a methyl ester derivative of an indole compound, exhibits several notable characteristics. This compound features an indole ring structure, which is a bicyclic structure composed of a benzene ring fused to a pyrrole ring, contributing to its aromatic properties. The presence of a methoxy group at the 5-position enhances its solubility and reactivity, while the propanoic acid moiety provides acidic characteristics. As a methyl ester, it is likely to be more lipophilic compared to its acid counterpart, influencing its biological activity and potential applications in pharmaceuticals or agrochemicals. The compound may exhibit various biological activities, including potential roles in plant growth regulation or as a precursor in synthetic organic chemistry. Its CAS number, 100372-62-1, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound's unique structural features and functional groups contribute to its significance in both chemical and biological contexts.
Formula:C13H15NO3
InChI:InChI=1S/C13H15NO3/c1-16-10-4-5-12-11(7-10)9(8-14-12)3-6-13(15)17-2/h4-5,7-8,14H,3,6H2,1-2H3
InChI key:UJZCGIMHNVFNMZ-UHFFFAOYSA-N
SMILES:COC1=CC2=C(C=C1)NC=C2CCC(=O)OC
Found 1 products.