CymitQuimica logo

CAS 100376-53-2

:

2-(2-AMINO-6-CHLOROPHENYL)ETHAN-1-OL

Description:
2-(2-Amino-6-chlorophenyl)ethan-1-ol, with the CAS number 100376-53-2, is an organic compound characterized by the presence of an amino group and a hydroxyl group attached to a phenyl ring. This compound features a chlorinated aromatic system, which contributes to its chemical reactivity and potential biological activity. The amino group (-NH2) is known for its ability to participate in hydrogen bonding and can influence the compound's solubility in water and organic solvents. The hydroxyl group (-OH) also enhances solubility and can engage in hydrogen bonding, making the compound polar. The presence of the chlorine atom on the phenyl ring can affect the electronic properties of the molecule, potentially impacting its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could confer specific biological activities. However, detailed studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C8H10ClNO
InChI:InChI=1/C8H10ClNO/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3,11H,4-5,10H2
InChI key:PVBOKNRVNJCKRR-UHFFFAOYSA-N
SMILES:c1cc(c(CCO)c(c1)N)Cl
Synonyms:
  • Timtec-Bb Sbb005689
  • 2-(2-Amino-6-Chlorophenyl)Ethanol
Found 2 products.