CymitQuimica logo

CAS 100377-67-1

:

Pentanoic acid, 5-oxo-5-(2-thiazolylamino)-

Description:
Pentanoic acid, 5-oxo-5-(2-thiazolylamino)-, also known by its CAS number 100377-67-1, is a chemical compound characterized by its unique structure that includes a pentanoic acid backbone and a thiazole ring. This compound features a ketone functional group (5-oxo) and an amino group attached to the thiazole, which contributes to its potential biological activity. It is typically a solid or liquid at room temperature, depending on its specific formulation and purity. The presence of the thiazole moiety suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anti-inflammatory agents. Its solubility can vary based on the presence of functional groups, and it may exhibit moderate to high polarity. Additionally, the compound's reactivity can be influenced by the functional groups present, making it a candidate for various chemical reactions, including esterification and amidation. Overall, pentanoic acid, 5-oxo-5-(2-thiazolylamino)- is of interest in both synthetic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C8H10N2O3S
InChI:InChI=1S/C8H10N2O3S/c11-6(2-1-3-7(12)13)10-8-9-4-5-14-8/h4-5H,1-3H2,(H,12,13)(H,9,10,11)
InChI key:KIGCPAJFAFXJHS-UHFFFAOYSA-N
SMILES:C1=CSC(=N1)NC(=O)CCCC(=O)O
Found 1 products.