CymitQuimica logo

CAS 100381-45-1

:

Benzenamine, N,N-dimethyl-4-(2-pyridinyl)-

Description:
Benzenamine, N,N-dimethyl-4-(2-pyridinyl)-, also known by its CAS number 100381-45-1, is an organic compound characterized by its amine functional group and aromatic structure. This compound features a dimethylamino group attached to a benzene ring, which is further substituted at the para position by a 2-pyridyl group. The presence of the pyridine ring contributes to its potential basicity and reactivity, making it useful in various chemical applications. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which enhances its utility in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Safety data indicates that it should be handled with care due to potential toxicity and irritant properties. Overall, its unique structure and functional groups make it a valuable compound in chemical research and industrial applications.
Formula:C13H14N2
InChI:InChI=1S/C13H14N2/c1-15(2)12-8-6-11(7-9-12)13-5-3-4-10-14-13/h3-10H,1-2H3
InChI key:QTBGSBRUWVUWCS-UHFFFAOYSA-N
SMILES:CN(C)C1=CC=C(C=C1)C2=CC=CC=N2
Found 2 products.