CAS 1003845-06-4
:2-Chloropyrimidine-5-Boronic Acid
Description:
2-Chloropyrimidine-5-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorinated pyrimidine ring. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, owing to the boronic acid moiety. The presence of the chlorine atom on the pyrimidine ring influences its reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The boronic acid group allows for participation in Suzuki coupling reactions, facilitating the formation of carbon-carbon bonds. Additionally, this compound may exhibit properties such as moderate stability under standard conditions, but it can be sensitive to moisture due to the boronic acid functionality. Its applications extend to medicinal chemistry, where it can serve as a building block for more complex molecules. As with many boronic acids, it is important to handle this compound with care, following appropriate safety protocols due to potential reactivity and toxicity.
Formula:C4H4BClN2O2
InChI:InChI=1/C4H4BClN2O2/c6-4-7-1-3(2-8-4)5(9)10/h1-2,9-10H
SMILES:c1c(cnc(Cl)n1)B(O)O
Synonyms:- 2-Chloro-5-pyrimidineboronic acid
- 2-Chloropyrimidin-5-Ylboronic Acid
- 2-Chloropyrimidin-5-Ylboronicacid
- 2-Chloro-5-pyrimidineboronicacid
- (2-Chloropyrimidin-5-Yl)Boronic Acid
- B-(2-Chloro-5-pyrimidinyl)boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloropyrimidine-5-boronic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H4BClN2O2Purity:96%Molecular weight:158.35Boronic acid, B-(2-chloro-5-pyrimidinyl)-
CAS:Formula:C4H4BClN2O2Purity:98%Color and Shape:SolidMolecular weight:158.35082-Chloropyrimidine-5-boronic acid
CAS:2-Chloropyrimidine-5-boronic acidFormula:C4H4BClN2O2Purity:98%Color and Shape:White SolidMolecular weight:158.350762-Chloro-5-pyrimidineboronic acid
CAS:Formula:C4H4BClN2O2Purity:97%Color and Shape:SolidMolecular weight:158.35



