CymitQuimica logo

CAS 1003856-13-0

:

1-(5-broMopyridin-3-yl)cyclopropanaMine hcl

Description:
1-(5-Bromopyridin-3-yl)cyclopropanamine hydrochloride, with the CAS number 1003856-13-0, is a chemical compound characterized by its unique structure that includes a cyclopropane ring and a brominated pyridine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and methanol, owing to the presence of the hydrochloride salt form. The bromine atom in the pyridine ring can impart specific reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry for the development of pharmaceuticals. The presence of the amine functional group allows for potential interactions with biological targets, contributing to its relevance in drug discovery. Additionally, the compound's properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C8H9BrN2
InChI:InChI=1S/C8H9BrN2/c9-7-3-6(4-11-5-7)8(10)1-2-8/h3-5H,1-2,10H2
InChI key:RUSNYPWBTXEEPZ-UHFFFAOYSA-N
SMILES:C1CC1(C2=CC(=CN=C2)Br)N
Synonyms:
  • 1-(5-broMopyridin-3-yl)cyclopropanaMine hcl
  • 1-(5-Bromopyridin-3-yl)cyclopropanamine
  • 1-(5-bromo-pyrid-3-yl)-cyclopropylamine
  • Cyclopropanamine, 1-(5-bromo-3-pyridinyl)-
  • 1-(5-bromopyridin-3-yl)cyclopropan-1-amine
Found 1 products.