CAS 1003859-12-8
:2,3-Dibromo-5-(bromomethyl)pyridine
Description:
2,3-Dibromo-5-(bromomethyl)pyridine is a brominated pyridine derivative characterized by the presence of two bromine atoms at the 2 and 3 positions and a bromomethyl group at the 5 position of the pyridine ring. This compound typically appears as a colorless to light yellow liquid or solid, depending on its form and purity. It is known for its reactivity due to the presence of multiple bromine substituents, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is of interest in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other functional materials. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous and may pose environmental risks.
Formula:C6H4Br3N
InChI:InChI=1S/C6H4Br3N/c7-2-4-1-5(8)6(9)10-3-4/h1,3H,2H2
InChI key:InChIKey=LJVWGDBHWSPNMN-UHFFFAOYSA-N
SMILES:C(Br)C=1C=C(Br)C(Br)=NC1
Synonyms:- Pyridine, 2,3-dibromo-5-(bromomethyl)-
- 2,3-Dibromo-5-(bromomethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
