CymitQuimica logo

CAS 100390-49-6

:

1-Pyrrolidineacetic acid, α-phenyl-, hydrochloride (1:1)

Description:
1-Pyrrolidineacetic acid, α-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine and phenyl functional groups, which contribute to its unique properties. This substance typically appears as a white to off-white crystalline solid and is soluble in water, indicating its ionic nature due to the presence of the hydrochloride salt. The compound is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs that target the central nervous system or exhibit analgesic properties. Its molecular structure includes a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and an acetic acid moiety, which may influence its biological activity. The hydrochloride form enhances its stability and solubility, making it more suitable for various formulations. As with many chemical substances, handling precautions should be observed, as it may pose risks if ingested or improperly managed. Overall, 1-Pyrrolidineacetic acid, α-phenyl-, hydrochloride is of interest in medicinal chemistry and pharmacology.
Formula:C12H15NO2·ClH
InChI:InChI=1S/C12H15NO2.ClH/c14-12(15)11(13-8-4-5-9-13)10-6-2-1-3-7-10;/h1-3,6-7,11H,4-5,8-9H2,(H,14,15);1H
InChI key:InChIKey=YSRMMTTWXDLPCV-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C1=CC=CC=C1)N2CCCC2.Cl
Synonyms:
  • 1-Pyrrolidineacetic acid, α-phenyl-, hydrochloride
  • 1-Pyrrolidineacetic acid, α-phenyl-, hydrochloride (1:1)
Found 2 products.