CymitQuimica logo

CAS 100394-14-7

:

3-[(2-NAPHTHYLSULFONYL)AMINO]PROPANOIC ACID

Description:
3-[(2-Naphthylsulfonyl)amino]propanoic acid, with the CAS number 100394-14-7, is an organic compound characterized by the presence of a propanoic acid backbone substituted with a sulfonamide group derived from 2-naphthylsulfonic acid. This compound typically exhibits properties associated with both acidic and amine functionalities, allowing it to participate in various chemical reactions, including those involving nucleophilic substitution and acid-base interactions. The naphthyl group contributes to its hydrophobic characteristics, while the sulfonyl and amino groups enhance its solubility in polar solvents. This compound may be utilized in pharmaceutical applications, particularly in the development of drugs targeting specific biological pathways. Its structural features suggest potential interactions with biological macromolecules, making it of interest in medicinal chemistry. Additionally, the presence of the sulfonamide moiety may impart unique pharmacological properties, influencing its biological activity and therapeutic potential. Overall, 3-[(2-naphthylsulfonyl)amino]propanoic acid represents a versatile compound with significant implications in chemical and pharmaceutical research.
Formula:C13H12NO4S
InChI:InChI=1/C13H13NO4S/c15-13(16)7-8-14-19(17,18)12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,14H,7-8H2,(H,15,16)/p-1
SMILES:c1ccc2cc(ccc2c1)S(=O)(=O)NCCC(=O)[O-]
Synonyms:
  • beta-Alanine, N-(2-naphthalenylsulfonyl)-
  • N-(2-Naphthylsulfonyl)-beta-alanine
  • N-(naphthalen-2-ylsulfonyl)-beta-alanine
  • 3-[(Naphthalen-2-Ylsulfonyl)Amino]Propanoate
  • 3-[(2-naphthylsulfonyl)amino]propanoic acid
Found 1 products.