CAS 1003993-40-5

1-[(2-Chloro-4-fluorophenoxy)methyl]-4-nitro-1H-pyrazole

Description:

1-[(2-Chloro-4-fluorophenoxy)methyl]-4-nitro-1H-pyrazole is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a nitro group, and a phenoxy moiety substituted with chlorine and fluorine. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitro group, which can participate in various chemical reactions. The chlorofluorophenoxy group may influence its biological activity, making it of interest in pharmaceutical research. The presence of halogens often enhances lipophilicity, which can affect the compound's interaction with biological systems. Additionally, the nitro group can serve as a functional handle for further chemical modifications. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed due to the presence of halogens and nitro groups, which can pose health risks.

Formula: C₁₀H₇ClFN₃O₃

InChI: InChI=1S/C10H7ClFN3O3/c11-9-3-7(12)1-2-10(9)18-6-14-5-8(4-13-14)15(16)17/h1-5H,6H2

InChI key: InChIKey=GFSBOAFTFWZKTQ-UHFFFAOYSA-N

SMILES: C(OC1=C(Cl)C=C(F)C=C1)N2C=C(N(=O)=O)C=N2

Synonyms:

• 1H-Pyrazole, 1-[(2-chloro-4-fluorophenoxy)methyl]-4-nitro-
• 1-[(2-Chloro-4-fluorophenoxy)methyl]-4-nitro-1H-pyrazole
• ART-CHEM-BB B024932
• AKOS B024932
• 1-(2-CHLORO-4-FLUORO-PHENOXYMETHYL)-4-NITRO-1H-PYRAZOLE

1-[(2-Chloro-4-fluorophenoxy)methyl]-4-nitro-1H-pyrazole

CAS: 1003993-40-5

1-[(2-Chloro-4-fluorophenoxy)methyl]-4-nitro-1H-pyrazole

Purity: ≥95%

Molecular weight: 271.63g/mol

Ref: 54-PC410024