CAS 1004-16-6
:Pyridinium, 3-cyano-1-methyl-, iodide (1:1)
Description:
Pyridinium, 3-cyano-1-methyl-, iodide (1:1), with the CAS number 1004-16-6, is a quaternary ammonium salt characterized by its pyridinium cation and iodide anion. The compound features a pyridine ring substituted at the 3-position with a cyano group and at the 1-position with a methyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and is soluble in polar solvents due to the ionic nature of the iodide. The presence of the cyano group enhances its reactivity, making it useful in various organic synthesis applications, including as a reagent in nucleophilic reactions. Additionally, the iodide ion can participate in halogenation reactions. The compound may exhibit biological activity, although specific pharmacological properties would require further investigation. Safety data should be consulted, as quaternary ammonium compounds can have varying degrees of toxicity and environmental impact. Overall, Pyridinium, 3-cyano-1-methyl-, iodide is a versatile compound in organic chemistry and materials science.
Formula:C7H7N2·I
InChI:InChI=1S/C7H7N2.HI/c1-9-4-2-3-7(5-8)6-9;/h2-4,6H,1H3;1H/q+1;/p-1
InChI key:InChIKey=QOYXETVGUYSYRK-UHFFFAOYSA-M
SMILES:C(#N)C1=C[N+](C)=CC=C1.[I-]
Synonyms:- 1-Methyl-3-cyanopyridinium iodide
- 3-Cyano-1-methylpyridin-1-ium iodide
- 3-Cyano-1-methylpyridinium iodide
- 3-Cyano-N-methylpyridinium iodide
- Pyridinium, 3-Cyano-1-Methyl-
- Pyridinium, 3-cyano-1-methyl-, iodide
- Pyridinium, 3-cyano-1-methyl-, iodide (1:1)
- 3-Cyano-1-methylpyridinium
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Cyano-1-methylpyridin-1-ium iodide
CAS:3-Cyano-1-methylpyridin-1-ium iodide is a reactive chemical that can be used as an electrophilic reagent. It reacts with amines, anilines, and pyridones to produce N-substituted pyridinium salts. 3-Cyano-1-methylpyridin-1-ium iodide also reacts with chloride ions to form the corresponding chlorides. This compound has been used in the synthesis of nucleophilic attack products such as benzyl bromide and phenylacetaldehyde.
Formula:C7H7IN2Purity:Min. 95%Molecular weight:246.05 g/mol
