CymitQuimica logo

CAS 1004-18-8

:

2,4-Pyrimidinediamine, N4-methyl- (9CI)

Description:
2,4-Pyrimidinediamine, N4-methyl- (9CI), with the CAS number 1004-18-8, is an organic compound characterized by its pyrimidine ring structure, which features two amino groups at the 2 and 4 positions and a methyl group attached to the nitrogen at the 4 position. This compound is typically a white to off-white solid and is soluble in water and various organic solvents, making it versatile for different applications. It is primarily used in the synthesis of pharmaceuticals, agrochemicals, and dyes due to its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of amino groups contributes to its basicity and reactivity, allowing it to form salts and complexes with acids and metal ions. Safety data indicates that, like many amines, it should be handled with care, as it may cause irritation to the skin, eyes, and respiratory system. Proper storage and handling procedures are essential to ensure safety and stability.
Formula:C5H8N4
InChI:InChI=1S/C5H8N4/c1-7-4-2-3-8-5(6)9-4/h2-3H,1H3,(H3,6,7,8,9)
InChI key:ZYRZYWIROWSDLB-UHFFFAOYSA-N
SMILES:CNC1=NC(=NC=C1)N
Found 2 products.