CAS 100414-80-0

Formula: C17H16O3

InChI: InChI=1S/C17H16O3/c1-10-8-17(19-9-10)14-7-6-12-11(2)4-3-5-13(12)15(14)16(18)20-17/h3-7,10H,8-9H2,1-2H3/t10-,17?/m1/s1

InChI key: DNLNYCCHXAULQA-YQDUUYOCSA-N

SMILES: C[C@@H]1CC2(C3=C(C4=CC=CC(=C4C=C3)C)C(=O)O2)OC1

Danshinspiroketallactone

CAS: 100414-80-0

Danshinspiroketallactone is a synthetic compound, specifically a spirolactone, derived from compounds naturally found in the roots of the plant Salvia miltiorrhiza, commonly known as Danshen. This plant is a traditional Chinese medicinal herb widely recognized for its therapeutic properties. The mode of action of Danshinspiroketallactone involves the inhibition of specific cellular pathways that are crucial for cancer cell proliferation and survival. It disrupts the signaling networks, particularly those responsible for tumor growth and apoptosis evasion, thereby exhibiting significant anticancer potential.

Formula: C₁₇H₁₆O₃

Purity: Min. 95%

Molecular weight: 268.31 g/mol

Ref: 3D-AEA41480