CymitQuimica logo

CAS 1004193-08-1

:

1-[(3-Chloro-4-fluorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid

Description:
1-[(3-Chloro-4-fluorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring, a carboxylic acid functional group, and a phenoxy group substituted with chlorine and fluorine atoms. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid group, which can participate in various chemical reactions, including esterification and amidation. The halogen substituents (chlorine and fluorine) can influence the compound's electronic properties and biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the pyrazole moiety may contribute to its potential as a bioactive agent, as pyrazole derivatives are often explored for their pharmacological properties. Overall, this compound's specific characteristics, including its molecular weight, melting point, and spectral data, would be essential for further applications in research and development.
Formula:C11H8ClFN2O3
InChI:InChI=1S/C11H8ClFN2O3/c12-8-5-7(1-2-9(8)13)18-6-15-4-3-10(14-15)11(16)17/h1-5H,6H2,(H,16,17)
InChI key:InChIKey=JXBKDZQBVWHPQT-UHFFFAOYSA-N
SMILES:C(OC1=CC(Cl)=C(F)C=C1)N2N=C(C(O)=O)C=C2
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 1-[(3-chloro-4-fluorophenoxy)methyl]-
  • 1-[(3-Chloro-4-fluorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid
Found 1 products.