CymitQuimica logo

CAS 1004193-84-3

:

1-[(2,3-Dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:
1-[(2,3-Dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a carboxylic acid functional group, and a hydrazide moiety. This compound features a dichlorophenoxy group that enhances its biological activity and solubility properties. It is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. The presence of the hydrazide functional group suggests potential reactivity, particularly in forming hydrazones or undergoing condensation reactions. This compound may be of interest in pharmaceutical research due to its potential biological activities, including herbicidal or fungicidal properties, as indicated by its structural components. Additionally, its molecular interactions could be explored in various applications, including agrochemicals or medicinal chemistry. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact.
Formula:C11H10Cl2N4O2
InChI:InChI=1S/C11H10Cl2N4O2/c12-7-2-1-3-9(10(7)13)19-6-17-5-4-8(16-17)11(18)15-14/h1-5H,6,14H2,(H,15,18)
InChI key:InChIKey=CJBMJTYFEMFWDF-UHFFFAOYSA-N
SMILES:C(OC1=C(Cl)C(Cl)=CC=C1)N2N=C(C(NN)=O)C=C2
Synonyms:
  • 1-[(2,3-Dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
  • 1H-Pyrazole-3-carboxylic acid, 1-[(2,3-dichlorophenoxy)methyl]-, hydrazide
Found 1 products.