CymitQuimica logo

CAS 1004194-26-6

:

1-Ethyl-N-(4-ethylphenyl)-1H-pyrazole-5-methanamine

Description:
1-Ethyl-N-(4-ethylphenyl)-1H-pyrazole-5-methanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with an ethyl group and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the ethylphenyl group enhances its hydrophobic characteristics, while the amine group may impart basicity and potential for hydrogen bonding. Such structural features suggest that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds of this nature may have applications in pharmaceuticals or agrochemicals, given the biological activity often associated with pyrazole derivatives. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise values. Safety data should also be consulted to understand any hazards associated with handling this compound.
Formula:C14H19N3
InChI:InChI=1S/C14H19N3/c1-3-12-5-7-13(8-6-12)15-11-14-9-10-16-17(14)4-2/h5-10,15H,3-4,11H2,1-2H3
InChI key:InChIKey=WSEILECCVCTXCG-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(CC)C=C1)C=2N(CC)N=CC2
Synonyms:
  • 1H-Pyrazole-5-methanamine, 1-ethyl-N-(4-ethylphenyl)-
  • 1-Ethyl-N-(4-ethylphenyl)-1H-pyrazole-5-methanamine
Found 1 products.