CAS 1004194-32-4

N-[2-(3,4-Dimethoxyphenyl)ethyl]-1-ethyl-1H-pyrazole-5-methanamine

Description:

N-[2-(3,4-Dimethoxyphenyl)ethyl]-1-ethyl-1H-pyrazole-5-methanamine, with the CAS number 1004194-32-4, is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a substituted phenyl group. The presence of the dimethoxy groups on the phenyl ring suggests potential for increased lipophilicity and biological activity, making it of interest in medicinal chemistry. The ethyl and methanamine substituents contribute to its overall molecular framework, potentially influencing its pharmacokinetic properties. This compound may exhibit various biological activities, possibly including effects on neurotransmitter systems, given its structural features. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be assessed through various analytical methods. As with many compounds in this class, understanding its interactions and mechanisms of action would be crucial for exploring its potential applications in pharmaceuticals or other fields.

Formula: C₁₆H₂₃N₃O₂

InChI: InChI=1S/C16H23N3O2/c1-4-19-14(8-10-18-19)12-17-9-7-13-5-6-15(20-2)16(11-13)21-3/h5-6,8,10-11,17H,4,7,9,12H2,1-3H3

InChI key: InChIKey=YABWFSQNHJXNGP-UHFFFAOYSA-N

SMILES: C(NCCC1=CC(OC)=C(OC)C=C1)C=2N(CC)N=CC2

Synonyms:

• 1H-Pyrazole-5-methanamine, N-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyl-
• N-[2-(3,4-Dimethoxyphenyl)ethyl]-1-ethyl-1H-pyrazole-5-methanamine

[2-(3,4-Dimethoxyphenyl)ethyl][(1-ethyl-1H-pyrazol-5-yl)methyl]amine

CAS: 1004194-32-4

Versatile small molecule scaffold

Formula: C₁₆H₂₃N₃O₂

Purity: Min. 95%

Molecular weight: 289.37 g/mol

Ref: 3D-EQB19432