
CAS 100440-25-3
:Terpentecin
Description:
Terpentecin, with the CAS number 100440-25-3, is a chemical compound that is primarily derived from natural sources, particularly from the resin of certain pine trees. It is characterized by its complex mixture of terpenes and terpenoids, which contribute to its distinctive odor and potential applications in various industries. Terpentecin is often utilized in the formulation of fragrances, flavorings, and as a solvent in paints and coatings due to its ability to dissolve a wide range of organic compounds. The substance exhibits properties such as volatility and a relatively low boiling point, making it suitable for applications requiring quick evaporation. Additionally, terpentecin may possess antimicrobial properties, which can enhance its utility in preserving products. However, like many organic solvents, it should be handled with care due to potential health hazards associated with inhalation or skin contact. Overall, terpentecin is valued for its versatility and effectiveness in both industrial and consumer products.
Formula:C20H28O6
InChI:InChI=1/C20H28O6/c1-11-6-5-7-13-18(3,12(2)16(24)17(25)19(11,13)4)8-14(22)20(10-26-20)15(23)9-21/h6,9,12-14,16,22,24H,5,7-8,10H2,1-4H3/t12-,13+,14-,16-,18-,19-,20+/s2
InChI key:InChIKey=ISTOHHFNKVUOKP-OOKAXWEHNA-N
SMILES:[C@H](C[C@@]1(C)[C@]2([C@](C)(C(=O)[C@H](O)[C@H]1C)C(C)=CCC2)[H])(O)[C@]3(C(C=O)=O)CO3
Synonyms:- 2-Oxiraneacetaldehyde, 2-[(1R)-1-hydroxy-2-[(1S,2S,3R,4aS,8aS)-1,2,3,4,4a,7,8,8a-octahydro-3-hydroxy-1,2,4a,5-tetramethyl-4-oxo-1-naphthalenyl]ethyl]-α-oxo-, (2S)-rel-(-)-
- Terpentecin
- Oxiraneacetaldehyde, 2-[1-hydroxy-2-(1,2,3,4,4a,7,8,8a-octahydro-3-hydroxy-1,2,4a,5-tetramethyl-4-oxo-1-naphthalenyl)ethyl]-α-oxo-, [1α[S*(R*)],2α,3β,4aβ,8aα]-(-)-
- rel-(-)-(2S)-2-[(1R)-1-Hydroxy-2-[(1S,2S,3R,4aS,8aS)-1,2,3,4,4a,7,8,8a-octahydro-3-hydroxy-1,2,4a,5-tetramethyl-4-oxo-1-naphthalenyl]ethyl]-α-oxo-2-oxiraneacetaldehyde
- Oxiraneacetaldehyde, 2-[(1R)-1-hydroxy-2-[(1S,2S,3R,4aS,8aS)-1,2,3,4,4a,7,8,8a-octahydro-3-hydroxy-1,2,4a,5-tetramethyl-4-oxo-1-naphthalenyl]ethyl]-α-oxo-, (2S)-rel-(-)-
Sort by
Found 1 products.
Terpentecin
CAS:Terpentecin is isolated from strain MF730-N6 and is active against leukemia L-1210 and Ehrlich ascites carcinoma.Formula:C20H28O6Color and Shape:SolidMolecular weight:364.438
