CymitQuimica logo

CAS 1004451-69-7

:

3-(1,3-Benzodioxol-5-yl)-1-phenyl-1H-pyrazole-4-carboxaldehyde

Description:
3-(1,3-Benzodioxol-5-yl)-1-phenyl-1H-pyrazole-4-carboxaldehyde is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a phenyl group, and a benzodioxole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the aldehyde functional group. The benzodioxole structure contributes to its potential biological activity, as compounds containing this moiety are often investigated for pharmacological properties. The presence of the pyrazole ring may also suggest potential applications in medicinal chemistry, particularly in the development of anti-inflammatory or analgesic agents. Additionally, the compound may exhibit fluorescence or other optical properties due to its conjugated system. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications. Overall, this compound represents a unique combination of structural features that may lend itself to various chemical and biological investigations.
Formula:C17H12N2O3
InChI:InChI=1S/C17H12N2O3/c20-10-13-9-19(14-4-2-1-3-5-14)18-17(13)12-6-7-15-16(8-12)22-11-21-15/h1-10H,11H2
InChI key:InChIKey=IVFWJLCVAHTFCT-UHFFFAOYSA-N
SMILES:C(=O)C=1C(=NN(C1)C2=CC=CC=C2)C=3C=C4C(=CC3)OCO4
Synonyms:
  • 3-(1,3-Dioxaindan-5-yl)-1-phenyl-1H-pyrazole-4-carbaldehyde
  • 3-(1,3-Benzodioxol-5-yl)-1-phenyl-1H-pyrazole-4-carboxaldehyde
  • 3-(1,3-Benzodioxol-5-yl)-1-phenyl-1H-pyrazole-4-carbaldehyde
  • 1H-Pyrazole-4-carboxaldehyde, 3-(1,3-benzodioxol-5-yl)-1-phenyl-
  • 3-(1,3-Benzodioxol-5-yl)-1-phenylpyrazole-4-carbaldehyde
Found 1 products.