CAS 1004643-36-0

1-[([1,1′-Biphenyl]-4-yloxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:

1-[([1,1′-Biphenyl]-4-yloxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a biphenyl moiety, a pyrazole ring, and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and pyrazoles, such as potential biological activity, including anti-inflammatory or antimicrobial effects. The presence of the biphenyl group may enhance its lipophilicity, influencing its solubility and interaction with biological membranes. The carboxylic acid component suggests the potential for forming salts or participating in acid-base reactions. Additionally, the hydrazide functionality can engage in various chemical reactions, including condensation and hydrazone formation. Overall, this compound's unique structure may contribute to its utility in medicinal chemistry and material science, although specific applications would depend on further empirical studies and characterization. As with any chemical substance, safety data and handling precautions should be observed, particularly due to the potential reactivity of hydrazides.

Formula: C₁₇H₁₆N₄O₂

InChI: InChI=1S/C17H16N4O2/c18-19-17(22)16-10-11-21(20-16)12-23-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-11H,12,18H2,(H,19,22)

InChI key: InChIKey=WOGZFVXKPGDUBC-UHFFFAOYSA-N

SMILES: O(CN1N=C(C(NN)=O)C=C1)C2=CC=C(C=C2)C3=CC=CC=C3

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 1-[([1,1′-biphenyl]-4-yloxy)methyl]-, hydrazide
• 1-[([1,1′-Biphenyl]-4-yloxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

1-(Biphenyl-4-yloxymethyl)-1H-pyrazole-3-carboxylic acid hydrazide

CAS: 1004643-36-0

Versatile small molecule scaffold

Formula: C₁₇H₁₆N₄O₂

Purity: Min. 95%

Molecular weight: 308.33 g/mol

Ref: 3D-EQB64336