CymitQuimica logo

CAS 1004643-41-7

:

1-[(4-Bromo-2-chlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:
1-[(4-Bromo-2-chlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a carboxylic acid functional group, and a hydrazide moiety. The presence of halogen substituents, specifically bromine and chlorine, on the phenoxy group contributes to its unique reactivity and potential biological activity. This compound is typically used in research settings, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential as a bioactive agent. Its hydrazide functionality may impart properties relevant to the inhibition of specific enzymes or pathways in biological systems. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring and the overall molecular structure. Safety data and handling precautions should be observed, as with any chemical, to mitigate risks associated with its use in laboratory settings.
Formula:C11H10BrClN4O2
InChI:InChI=1S/C11H10BrClN4O2/c12-7-1-2-10(8(13)5-7)19-6-17-4-3-9(16-17)11(18)15-14/h1-5H,6,14H2,(H,15,18)
InChI key:InChIKey=YNLDVQMWNYDZKX-UHFFFAOYSA-N
SMILES:C(OC1=C(Cl)C=C(Br)C=C1)N2N=C(C(NN)=O)C=C2
Synonyms:
  • 1-[(4-Bromo-2-chlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
  • 1H-Pyrazole-3-carboxylic acid, 1-[(4-bromo-2-chlorophenoxy)methyl]-, hydrazide
Found 1 products.