CymitQuimica logo

CAS 1004643-70-2

:

1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid

Description:
1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) at the 5-position significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The carboxylic acid functional group at the 3-position contributes to its acidity and reactivity, making it a versatile compound in organic synthesis and medicinal chemistry. This compound may exhibit interesting pharmacological properties, particularly in the development of agrochemicals or pharmaceuticals, due to the unique combination of its functional groups. Additionally, its molecular structure suggests potential applications in various fields, including materials science and biochemistry. The compound's stability, solubility, and reactivity can be influenced by the presence of the trifluoromethyl group, which is known to impart unique electronic properties. Overall, 1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid is a noteworthy compound for further research and application.
Formula:C7H7F3N2O2
InChI:InChI=1S/C7H7F3N2O2/c1-2-12-5(7(8,9)10)3-4(11-12)6(13)14/h3H,2H2,1H3,(H,13,14)
InChI key:InChIKey=BJLMBVOXZSMLJE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N(CC)N=C(C(O)=O)C1
Synonyms:
  • 1-ethyl-5-trifluoromethyl-1 h-pyrazole-3-carboxylic acid
  • 1H-Pyrazole-3-carboxylic acid, 1-ethyl-5-(trifluoromethyl)-
  • 1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid
  • ART-CHEM-BB B021151
  • AKOS B021151
  • 1-Ethyl-5-(trifluoromethyl)pyrazole-3-carboxylic acid
Found 3 products.