CymitQuimica logo

CAS 1004644-03-4

:

4-(1,3-Dimethyl-1H-pyrazol-4-yl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidine

Description:
4-(1,3-Dimethyl-1H-pyrazol-4-yl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidine is a chemical compound characterized by its complex structure, which includes a pyrimidine core substituted with a hydrazine group and a trifluoromethyl group, as well as a dimethylpyrazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its unique functional groups. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Additionally, the hydrazine functionality may contribute to its potential as a ligand in coordination chemistry or as a precursor in synthetic pathways. The compound's molecular structure suggests it may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its stability, solubility, and reactivity would depend on the specific conditions and solvents used in experiments. As with many such compounds, safety and handling precautions are essential due to the potential toxicity associated with hydrazine derivatives.
Formula:C10H11F3N6
InChI:InChI=1S/C10H11F3N6/c1-5-6(4-19(2)18-5)7-3-8(10(11,12)13)16-9(15-7)17-14/h3-4H,14H2,1-2H3,(H,15,16,17)
InChI key:InChIKey=KBPFVIUFYDBBGX-UHFFFAOYSA-N
SMILES:CC=1C(=CN(C)N1)C2=CC(C(F)(F)F)=NC(=NN)N2
Synonyms:
  • Pyrimidine, 4-(1,3-dimethyl-1H-pyrazol-4-yl)-2-hydrazinyl-6-(trifluoromethyl)-
  • 4-(1,3-Dimethyl-1H-pyrazol-4-yl)-2-hydrazinyl-6-(trifluoromethyl)pyrimidine
Found 1 products.