CAS 1004644-55-6

4-Chloro-3-methyl-1H-pyrazole-1-acetic acid hydrazide

Description:

4-Chloro-3-methyl-1H-pyrazole-1-acetic acid hydrazide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a chloro substituent at the 4-position and a methyl group at the 3-position of the pyrazole ring, contributing to its unique reactivity and properties. The presence of the hydrazide functional group enhances its potential for forming hydrogen bonds, making it useful in various chemical reactions and applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The compound's structure suggests potential biological activity, which has led to interest in its use in pharmaceuticals and agrochemicals. As with many pyrazole derivatives, it may possess anti-inflammatory, antimicrobial, or other therapeutic properties, although specific biological activities would need to be confirmed through empirical studies. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₆H₉ClN₄O

InChI: InChI=1S/C6H9ClN4O/c1-4-5(7)2-11(10-4)3-6(12)9-8/h2H,3,8H2,1H3,(H,9,12)

InChI key: InChIKey=YYGIOJSFYFIUSP-UHFFFAOYSA-N

SMILES: C(C(NN)=O)N1C=C(Cl)C(C)=N1

Synonyms:

• 1H-Pyrazole-1-acetic acid, 4-chloro-3-methyl-, hydrazide
• 4-Chloro-3-methyl-1H-pyrazole-1-acetic acid hydrazide

2-(4-Chloro-3-methyl-1H-pyrazol-1-yl)acetohydrazide

CAS: 1004644-55-6

Versatile small molecule scaffold

Formula: C₆H₉ClN₄O

Purity: Min. 95%

Molecular weight: 188.61 g/mol

Ref: 3D-EQB64455