CymitQuimica logo

CAS 1004644-59-0

:

4-Bromo-5-methyl-1H-pyrazole-1-propanoic acid hydrazide

Description:
4-Bromo-5-methyl-1H-pyrazole-1-propanoic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom and a methyl group, along with a propanoic acid hydrazide moiety. This compound typically exhibits properties associated with both hydrazides and pyrazoles, such as potential biological activity and reactivity due to the presence of the hydrazide functional group. The bromine substitution can influence its lipophilicity and reactivity, making it of interest in medicinal chemistry and agrochemical applications. The compound may also display specific solubility characteristics in various solvents, which can affect its application in synthesis and formulation. Additionally, its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in pharmacology. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of bromine, which can be hazardous.
Formula:C7H11BrN4O
InChI:InChI=1S/C7H11BrN4O/c1-5-6(8)4-10-12(5)3-2-7(13)11-9/h4H,2-3,9H2,1H3,(H,11,13)
InChI key:InChIKey=JVFMDMXKKHVOQK-UHFFFAOYSA-N
SMILES:C(CC(NN)=O)N1C(C)=C(Br)C=N1
Synonyms:
  • 4-Bromo-5-methyl-1H-pyrazole-1-propanoic acid hydrazide
  • 1H-Pyrazole-1-propanoic acid, 4-bromo-5-methyl-, hydrazide
Found 1 products.