CymitQuimica logo

CAS 100478-25-9

:

4,6-BIS(DIFLUOROMETHOXY)-2-(METHYLTHIO)PYRIMIDINE

Description:
4,6-Bis(difluoromethoxy)-2-(methylthio)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is substituted at positions 2, 4, and 6. The presence of difluoromethoxy groups at the 4 and 6 positions contributes to its unique electronic properties, enhancing its potential as a pharmaceutical intermediate or active ingredient. The methylthio group at position 2 introduces a sulfur atom, which can influence the compound's reactivity and solubility. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents, due to the presence of fluorine atoms that can enhance biological activity. Additionally, the compound's solubility and stability in various solvents can be influenced by the functional groups present, making it a subject of interest in drug formulation and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H6F4N2O2S
InChI:InChI=1/C7H6F4N2O2S/c1-16-7-12-3(14-5(8)9)2-4(13-7)15-6(10)11/h2,5-6H,1H3
InChI key:HURDQHYOXAOOJJ-UHFFFAOYSA-N
SMILES:CSc1nc(cc(n1)OC(F)F)OC(F)F
Synonyms:
  • 4,6-Bis(difluoromethoxy)-2-(methylsulfanyl)pyrimidine
  • Pyrimidine, 4,6-Bis(Difluoromethoxy)-2-(Methylthio)-
Found 4 products.