CymitQuimica logo

CAS 100491-30-3

:

Ethyl 7-chloro-6-fluoro-1-(4-fluorophenyl)-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylate

Description:
Ethyl 7-chloro-6-fluoro-1-(4-fluorophenyl)-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylate is a synthetic organic compound characterized by its complex structure, which includes a naphthyridine core, a carboxylate ester group, and multiple halogen substituents. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of fluorine and chlorine atoms often enhances lipophilicity and can influence the compound's pharmacokinetic properties. Its molecular structure suggests potential interactions with biological targets, which may lead to applications in medicinal chemistry, particularly in the development of antimicrobial or anticancer agents. Additionally, the compound's stability and reactivity can be influenced by the presence of the carboxylate group, which may participate in various chemical reactions. Overall, this compound represents a class of heterocyclic compounds that are valuable in drug discovery and development.
Formula:C17H11ClF2N2O3
InChI:InChI=1S/C17H11ClF2N2O3/c1-2-25-17(24)12-8-22(10-5-3-9(19)4-6-10)16-11(14(12)23)7-13(20)15(18)21-16/h3-8H,2H2,1H3
InChI key:InChIKey=CLVHZNISFZIYKK-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CN(C=2C(C1=O)=CC(F)=C(Cl)N2)C3=CC=C(F)C=C3
Synonyms:
  • 1,8-Naphthyridine-3-carboxylic acid, 7-chloro-6-fluoro-1-(4-fluorophenyl)-1,4-dihydro-4-oxo-, ethyl ester
  • Ethyl 7-chloro-6-fluoro-1-(4-fluorophenyl)-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylate
Found 1 products.