CymitQuimica logo

CAS 100491-37-0

:

1,8-Naphthyridine-3-carboxylic acid,7-chloro-1-(4-chlorophenyl)-6-fluoro-1,4-dihydro-4-oxo-, ethyl ester

Description:
1,8-Naphthyridine-3-carboxylic acid, 7-chloro-1-(4-chlorophenyl)-6-fluoro-1,4-dihydro-4-oxo-, ethyl ester, identified by CAS number 100491-37-0, is a synthetic organic compound characterized by its complex structure that includes a naphthyridine core, a carboxylic acid functional group, and various halogen substituents. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of chlorine and fluorine atoms suggests enhanced lipophilicity and may influence its interaction with biological targets. Additionally, the ethyl ester moiety can affect the compound's reactivity and stability, potentially impacting its pharmacokinetic properties. Overall, this compound's unique structural features may contribute to its utility in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise characterization.
Formula:C17H11Cl2FN2O3
InChI:InChI=1S/C17H11Cl2FN2O3/c1-2-25-17(24)12-8-22(10-5-3-9(18)4-6-10)16-11(14(12)23)7-13(20)15(19)21-16/h3-8H,2H2,1H3
InChI key:VDJXNRLOCJTVIP-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CN(C2=NC(=C(C=C2C1=O)F)Cl)C3=CC=C(C=C3)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.