CAS 1005-38-5
:6-Chloro-2-(methylthio)pyrimidin-4-amine
Description:
6-Chloro-2-(methylthio)pyrimidin-4-amine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both chlorine and methylthio substituents. The presence of the chlorine atom at the 6-position and the methylthio group at the 2-position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. It is often used in pharmaceutical research and development due to its potential biological activity, particularly in the synthesis of various bioactive molecules. The amine functional group at the 4-position enhances its reactivity, making it a useful intermediate in organic synthesis. Additionally, its molecular structure allows for various interactions with biological targets, which can be explored for therapeutic applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H6ClN3S
InChI:InChI=1S/C5H6ClN3S/c1-10-5-8-3(6)2-4(7)9-5/h2H,1H3,(H2,7,8,9)
InChI key:InChIKey=ISUXMAHVLFRZQU-UHFFFAOYSA-N
SMILES:S(C)C=1N=C(Cl)C=C(N)N1
Synonyms:- (6-Chloro-2-methylsulfanylpyrimidin-4-yl)amine
- 4-Amino-6-chloro-2-(methylthio)pyrimidine
- 4-Amino-6-chloro-2-methylsulfanylpyrimidine
- 4-Amino-6-chloro-2-methylthiopyrimidine
- 4-Pyrimidinamine, 6-chloro-2-(methylthio)-
- 6-Amino-4-chloro-2-(methylsulfanyl)pyrimidine
- 6-Chloro-2-(methylthio)-4-pyrimidinamine
- 6-Chloro-2-(methylthio)pyrimidin-4-amine
- 6-Chloro-2-methylsulfanyl-pyrimidin-4-amine
- 6-Chloro-2-methylthiopyrimidin-4-ylamine
- NSC 19859
- Pyrimidine, 4-amino-6-chloro-2-(methylthio)-
- See more synonyms
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Amino-6-chloro-2-(methylthio)pyrimidine
CAS:Formula:C5H6ClN3SPurity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:175.634-Amino-6-chloro-2-(methylthio)pyrimidine
CAS:Formula:C5H6ClN3SPurity:98%Color and Shape:SolidMolecular weight:175.63924-Amino-6-chloro-2-(methylthio)pyrimidine
CAS:4-Amino-6-chloro-2-(methylthio)pyrimidineFormula:C5H6ClN3SPurity:95%Molecular weight:175.644-Amino-6-chloro-2-(methylthio)pyrimidine
CAS:4-Amino-6-chloro-2-(methylthio)pyrimidineFormula:C5H6ClN3SPurity:99%Color and Shape:SolidMolecular weight:175.639234-Amino-6-chloro-2-(methylthio)pyrimidine
CAS:Formula:C5H6ClN3SPurity:95%Color and Shape:SolidMolecular weight:175.634-Amino-6-chloro-2-(methylthio) pyrimidine
CAS:4-Amino-6-chloro-2-(methylthio) pyrimidine is a reactive chemical that is used in medicine as an antioxidant. It has been shown to have beneficial effects on atherosclerosis, colitis and cancer. 4-Amino-6-chloro-2-(methylthio) pyrimidine has also been shown to inhibit the production of reactive oxygen species (ROS). ROS are generated by lipoxygenase enzymes in soybean oil and cause damage to cells. 4-Amino-6-chloro-2-(methylthio) pyrimidine binds to the enzyme's heme group, preventing it from forming ROS.Formula:C5H6ClN3SPurity:Min. 95%Molecular weight:175.64 g/mol





