CymitQuimica logo

CAS 1005-71-6

:

2,2,6,6-tetramethyl-1,2,3,6-tetrahydropyridine hydrochloride (1:1)

Description:
2,2,6,6-Tetramethyl-1,2,3,6-tetrahydropyridine hydrochloride is a chemical compound characterized by its tetrahydropyridine structure, which features a saturated six-membered ring containing nitrogen. The presence of four methyl groups at the 2 and 6 positions contributes to its steric bulk and influences its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in organic synthesis and as a reagent in chemical reactions. This compound is known for its role as a reducing agent and is often utilized in the synthesis of various organic compounds. Its stability and reactivity can be affected by environmental conditions such as pH and temperature. Safety data indicates that, like many nitrogen-containing compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 2,2,6,6-tetramethyl-1,2,3,6-tetrahydropyridine hydrochloride is a valuable compound in the field of organic chemistry.
Formula:C9H18ClN
InChI:InChI=1/C9H17N.ClH/c1-8(2)6-5-7-9(3,4)10-8;/h5-6,10H,7H2,1-4H3;1H
InChI key:AZVPCYQSAXQGNZ-UHFFFAOYSA-N
SMILES:CC1(C)C=CCC(C)(C)N1.Cl
Found 2 products.