CymitQuimica logo

CAS 10050-08-5

:

TRI-O-TOLYLBISMUTHINE

Description:
Tri-o-tolylbismuthine, with the CAS number 10050-08-5, is an organobismuth compound characterized by the presence of three o-tolyl (ortho-methylphenyl) groups attached to a central bismuth atom. This compound typically exhibits a white to pale yellow solid form and is known for its relatively low solubility in water, while being more soluble in organic solvents. Tri-o-tolylbismuthine is of interest in various fields, including organic synthesis and materials science, due to its potential applications in catalysis and as a precursor for other bismuth-containing compounds. The presence of the o-tolyl groups contributes to its unique electronic properties, making it a subject of study in coordination chemistry. Additionally, bismuth compounds are often explored for their low toxicity compared to other heavy metals, which enhances their appeal in both industrial and pharmaceutical applications. However, handling should still be conducted with care, as with all chemical substances, to ensure safety and compliance with relevant regulations.
Formula:C21H21Bi
InChI:InChI=1/3C7H7.Bi/c3*1-7-5-3-2-4-6-7;/h3*2-5H,1H3;/rC21H21Bi/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3/h4-15H,1-3H3
InChI key:DWIMJCTYUMGECA-UHFFFAOYSA-N
SMILES:Cc1ccccc1[Bi](c1ccccc1C)c1ccccc1C
Synonyms:
  • Tris(2-Methylphenyl)Bismuthine
  • Bismuthine,tris[2-methylphenyl]-
  • Tris(2-Methylphenyl)Bismuthane
Found 3 products.