CymitQuimica logo

CAS 100501-55-1

:

1-BOC-3-FORMYL-4-OXO-PIPERIDINE

Description:
1-BOC-3-formyl-4-oxo-piperidine, identified by its CAS number 100501-55-1, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The "1-BOC" designation indicates the presence of a tert-butyloxycarbonyl (BOC) protecting group at the nitrogen atom, which is commonly used in organic synthesis to protect amines. The "3-formyl" and "4-oxo" substituents denote the presence of an aldehyde group at the 3-position and a ketone group at the 4-position of the piperidine ring, respectively. This compound is typically utilized in organic synthesis and medicinal chemistry, often serving as an intermediate in the preparation of more complex molecules. Its reactivity is influenced by the functional groups present, allowing for various chemical transformations. As with many nitrogen-containing compounds, it may exhibit biological activity, making it of interest in pharmaceutical research. Proper handling and safety measures should be observed due to potential hazards associated with its chemical properties.
Formula:C11H17NO4
InChI:InChI=1S/C11H17NO4/c1-11(2,3)16-10(15)12-5-4-9(14)8(6-12)7-13/h7-8H,4-6H2,1-3H3
InChI key:ZKIQUKVRBZWAMF-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(=O)C(C1)C=O
Synonyms:
  • 3-Formyl-4-Oxo-Piperidine-1-Carboxylic Acid Tert-Butyl Ester
Found 2 products.